For research use only. Not for therapeutic Use.
ALK5-IN-34（Cat No.:I042862）is a selective inhibitor of the ALK5 receptor, which plays a key role in transforming growth factor-beta (TGF-β) signaling. By inhibiting ALK5, it modulates the TGF-β pathway, which is implicated in various fibrotic and inflammatory diseases. ALK5-IN-34 is being explored for its potential therapeutic applications in diseases such as cancer, fibrosis, and autoimmune disorders, where aberrant TGF-β signaling contributes to disease progression. Its ability to selectively target the ALK5 receptor makes it a promising candidate for developing more effective treatments with reduced side effects.
| CAS Number | 2785430-90-0 |
| Synonyms | 4-N-(8-methylcinnolin-4-yl)-2-N-(3-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| Molecular Formula | C23H23N7O |
| Purity | ≥95% |
| IUPAC Name | 4-N-(8-methylcinnolin-4-yl)-2-N-(3-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| InChI | InChI=1S/C23H23N7O/c1-16-4-2-7-19-20(15-25-29-22(16)19)27-21-8-9-24-23(28-21)26-17-5-3-6-18(14-17)30-10-12-31-13-11-30/h2-9,14-15H,10-13H2,1H3,(H2,24,26,27,28,29) |
| InChIKey | MCNUKNAEEMORHW-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CN=N2)NC3=NC(=NC=C3)NC4=CC(=CC=C4)N5CCOCC5 |
