For research use only. Not for therapeutic Use.
Alkannin(Cat No.:R072408), is a natural red pigment found in the roots of Alkanna tinctoria plants. It has been traditionally used as a dye in textiles, cosmetics, and food products. Alkannin exhibits antioxidant, anti-inflammatory, and antimicrobial properties, making it potentially beneficial for human health. It has also been investigated for its potential therapeutic applications, including antimicrobial effects and anticancer activity. Alkannin is generally considered safe for use in cosmetic and food applications. Its chemical structure is characterized by a naphthoquinone core with hydroxyl groups.
CAS Number | 517-88-4 |
Molecular Formula | C16H16O5 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C, protect from light |
IUPAC Name | 5,8-dihydroxy-2-[(1S)-1-hydroxy-4-methylpent-3-enyl]naphthalene-1,4-dione |
InChI | InChI=1S/C16H16O5/c1-8(2)3-4-10(17)9-7-13(20)14-11(18)5-6-12(19)15(14)16(9)21/h3,5-7,10,17-19H,4H2,1-2H3/t10-/m0/s1 |
InChIKey | NEZONWMXZKDMKF-JTQLQIEISA-N |
SMILES | CC(=CCC(C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |