For research use only. Not for therapeutic Use.
Retinal(Cat No.:R000403), is a naturally occurring compound and a form of vitamin A. It is an essential component of the visual pigment rhodopsin, found in the retina of the eye, which is crucial for vision. Retina plays a vital role in the process of capturing light and converting it into electrical signals that the brain can interpret as visual information. It acts as a chromophore, undergoing structural changes upon absorption of light, which triggers a cascade of events leading to nerve impulses being sent to the brain. In addition to its role in vision, the retina also contributes to various physiological processes, including cell growth, differentiation, and immune function.
CAS Number | 116-31-4 |
Synonyms | (all-E)-3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraenal; all -trans-Vitamin A Aldehyde; Retinene; |
Molecular Formula | C20H28O |
Purity | ≥95% |
Documentation | |
Target | Apoptosis |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal |
InChI | InChI=1S/C20H28O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ |
InChIKey | NCYCYZXNIZJOKI-OVSJKPMPSA-N |
SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=O)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |