All-trans-retinol is the most biologically active form of vitamin A, also known as retinol. It plays a critical role in several physiological processes, including vision, cell growth, immune function, and maintaining the integrity of epithelial tissues. Retinol is a precursor to other important vitamin A derivatives, such as retinal (involved in vision) and retinoic acid (involved in gene regulation and cell differentiation). It is widely used in skincare products due to its ability to stimulate collagen production, promote skin renewal, and reduce signs of aging. All-trans-retinol is also essential for healthy vision, particularly in low-light conditions.
| Catalog Number | R001261 |
| CAS Number | 68-26-8 |
| Synonyms | (all-E)-3,7-Dimethyl-9-(2,6,6-trimethyl-1-cyclohexen-1-yl)-2,4,6,8-nonatetraen-1-ol; A-Mulsal; A-Sol; Alphalin; Alphasterol; Anatola; Avita; Avitol; Axerol; NSC 122759; Vitamin A; Vitamin A1; Vitamin A1 Alcohol; Vitavel A; Vitpex; Vogan; trans-Retino |
| Molecular Formula | C20H30O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol |
| InChI | InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8+,17-13+ |
| InChIKey | FPIPGXGPPPQFEQ-OVSJKPMPSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CCO)C)C |
