For research use only. Not for therapeutic Use.
Allethrin(Cat No.:R055911), is a synthetic pyrethroid insecticide widely used for its potent insecticidal properties. It effectively targets and eliminates a broad range of insects, including mosquitoes, flies, ants, and cockroaches. Available in various formulations, such as aerosols, coils, and liquids, it acts by disrupting the nervous system of insects. Allethrin is considered to have low toxicity to mammals and aquatic organisms.
CAS Number | 584-79-2 |
Synonyms | Allethrine; 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)-cyclopropanecarboxylic Acid 2-methyl-4-oxo-3-(2-propen-1-yl)-2-cyclopenten-1-yl Ester; Allyl cinerin I; EBT; ENT 17510; Esbiothrine; Exthrin; Matox; NSC 11782; OMS 3045; Pynamin forte; Pyresyn; RU 2 |
Molecular Formula | C19H26O3 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 2-8°C |
IUPAC Name | (2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
InChI | InChI=1S/C19H26O3/c1-7-8-13-12(4)16(10-15(13)20)22-18(21)17-14(9-11(2)3)19(17,5)6/h7,9,14,16-17H,1,8,10H2,2-6H3 |
InChIKey | ZCVAOQKBXKSDMS-UHFFFAOYSA-N |
SMILES | CC1=C(C(=O)CC1OC(=O)C2C(C2(C)C)C=C(C)C)CC=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |