For research use only. Not for therapeutic Use.
Allocholic Acid is a high-purity bile acid derivative essential for advanced pharmaceutical and biochemical research. This compound is crucial for studies involving bile acid metabolism, liver function, and cholesterol regulation. Known for its stability and bioactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
CAS Number | 2464-18-8 |
Synonyms | 3-α,7-α,12-α-Trihydroxy-5-α-cholanoic Acid; 5α-Cholic Acid; |
Molecular Formula | C24H40O5 |
Purity | ≥95% |
Target | Disease Research Fields |
Storage | -20°C |
IUPAC Name | (4R)-4-[(3R,5R,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
InChI | InChI=1S/C24H40O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-20,22,25-27H,4-12H2,1-3H3,(H,28,29)/t13-,14-,15-,16-,17+,18+,19-,20+,22+,23+,24-/m1/s1 |
InChIKey | BHQCQFFYRZLCQQ-PGHAKIONSA-N |
SMILES | CC(CCC(=O)O)C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C |