For research use only. Not for therapeutic Use.
Allocinnamic acid(Cat No.:M070684), or α-methylcinnamic acid, is a naturally occurring compound found in cinnamon and other plant sources. Its molecular structure comprises a phenyl group attached to a propenoic acid functional group. This compound possesses diverse applications in organic synthesis, fragrance industry, and pharmaceuticals due to its aromatic properties and reactivity. It serves as a precursor in synthesizing various compounds like pharmaceuticals, flavoring agents, and UV-absorbing materials. Additionally, allocinnamic acid exhibits potential pharmacological activities, including antimicrobial and antioxidant properties, making it a subject of interest in biomedical research.
CAS Number | 102-94-3 |
Molecular Formula | C9H8O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (Z)-3-phenylprop-2-enoic acid |
InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6- |
InChIKey | WBYWAXJHAXSJNI-SREVYHEPSA-N |
SMILES | C1=CC=C(C=C1)C=CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |