For research use only. Not for therapeutic Use.
Allopurinol-d2 is a high-purity, deuterium-labeled derivative of allopurinol, essential for advanced pharmaceutical and biochemical research. This compound, featuring two deuterium atoms, is crucial for studying drug metabolism, pharmacokinetics, and uric acid inhibition. Its stable isotope labeling ensures precise and reliable results in mass spectrometry and other analytical techniques. Ideal for cutting-edge research in gout treatment and xanthine oxidase inhibition, Allopurinol-d2 enhances the accuracy of experimental data, supporting the development of therapeutic strategies and drug efficacy studies.
CAS Number | 916979-34-5 |
Synonyms | 1,5-Dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one-d2; 4-Hydroxypyrazolo[3,4-d]pyrimidine-d2; 4-Oxopyrazolo[3,4-d]pyrimidine-d2; Adenock-d2; Allopur-d2; Caplenal-d2; Cellidrin-d2; NSC 101655-d2; NSC 1390-d2; |
Molecular Formula | C5H4N4O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3,6-dideuterio-1,2-dihydropyrazolo[3,4-d]pyrimidin-4-one |
InChI | InChI=1S/C5H4N4O/c10-5-3-1-8-9-4(3)6-2-7-5/h1-2H,(H2,6,7,8,9,10)/i1D,2D |
InChIKey | OFCNXPDARWKPPY-QDNHWIQGSA-N |
SMILES | C1=C2C(=NC=NC2=O)NN1 |