For research use only. Not for therapeutic Use.
Allopurinol riboside(Cat No.:M078004) is a chemical compound derived from allopurinol, a medication commonly used to treat gout and kidney stones. Its mode of action and pharmacological effects involve interactions with enzymes and cellular processes due to its specific chemical structure. Allopurinol riboside has been studied for its potential bioactivities, including inhibition of xanthine oxidase and reduction of uric acid levels. It also exhibits potential in modulating purine metabolism and preventing the formation of uric acid crystals.
Catalog Number | M078004 |
CAS Number | 16220-07-8 |
Molecular Formula | C10H12N4O5 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | Store at -20°C |
IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5H-pyrazolo[3,4-d]pyrimidin-4-one |
InChI | InChI=1S/C10H12N4O5/c15-2-5-6(16)7(17)10(19-5)14-8-4(1-13-14)9(18)12-3-11-8/h1,3,5-7,10,15-17H,2H2,(H,11,12,18)/t5-,6-,7-,10-/m1/s1 |
InChIKey | KFQUAMTWOJHPEJ-DAGMQNCNSA-N |
SMILES | C1=NN(C2=C1C(=O)NC=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |