For research use only. Not for therapeutic Use.
Allyl α-D-Galactopyranoside (Cat.No:R000004) is a chemical compound used in carbohydrate chemistry and flavor research. It is an allyl glycoside derivative of α-D-galactopyranose, commonly employed as a synthetic intermediate to create various glycoside compounds. Its applications range from pharmaceutical synthesis to enhancing flavor and aroma in the food industry.
Catalog Number | R000004 |
CAS Number | 48149-72-0 |
Synonyms | α-D-Galactose Monoallyl Ether; 2-Propen-1-yl α-D-Galactopyranoside; |
Molecular Formula | C9H16O6 |
Purity | ≥95% |
Storage | Desiccate at -20°C |
IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4,5-triol |
InChI | InChI=1S/C9H16O6/c1-2-3-14-9-8(13)7(12)6(11)5(4-10)15-9/h2,5-13H,1,3-4H2/t5-,6+,7+,8-,9+/m1/s1 |
InChIKey | XJNKZTHFPGIJNS-NXRLNHOXSA-N |
SMILES | C=CCOC1C(C(C(C(O1)CO)O)O)O |