For research use only. Not for therapeutic Use.
Allyl heptanoate is an ester that is formed by the esterification of medium-chain fatty acids, heptanoic acid and allyl alcohol. The compound has a fruity smell and is commonly used as a flavoring in foods such as baked goods, candy and beverages.
Allyl heptanoate is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Catalog Number | M067822 |
| CAS Number | 142-19-8 |
| Synonyms | prop-2-enyl heptanoate |
| Molecular Formula | C10H18O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C10H18O2/c1-3-5-6-7-8-10(11)12-9-4-2/h4H,2-3,5-9H2,1H3 |
| InChIKey | SJWKGDGUQTWDRV-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)OCC=C |
