For research use only. Not for therapeutic Use.
Allylacetone(Cat No.:M069604)is an organic compound featuring both an allyl group and a ketone functional group. It is widely used in organic synthesis and chemical research as a versatile intermediate for creating a variety of complex molecules. The allyl group allows for reactions such as polymerization and cross-coupling, while the ketone functionality is useful in aldol reactions and other transformations. Allylacetone is particularly valuable in the synthesis of fragrances, pharmaceuticals, and agrochemicals. Its high reactivity and purity ensure consistent performance in advanced research and industrial applications.
CAS Number | 109-49-9 |
Molecular Formula | C6H10O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | hex-5-en-2-one |
InChI | InChI=1S/C6H10O/c1-3-4-5-6(2)7/h3H,1,4-5H2,2H3 |
InChIKey | RNDVGJZUHCKENF-UHFFFAOYSA-N |
SMILES | CC(=O)CCC=C |