For research use only. Not for therapeutic Use.
ALM301（Cat No.:I042748）is a novel, small molecule inhibitor targeting the ALK2 receptor, a key mediator in the bone morphogenetic protein (BMP) signaling pathway. This pathway plays a critical role in regulating cellular processes such as differentiation, proliferation, and survival. ALM301 is being investigated for its therapeutic potential in treating diseases associated with dysregulated BMP signaling, including fibrodysplasia ossificans progressiva (FOP), a rare genetic disorder characterized by abnormal bone growth. By selectively inhibiting ALK2, ALM301 holds promise as a targeted therapy for FOP and other BMP-related conditions, offering a more effective and precise treatment approach.
| CAS Number | 1313439-71-2 |
| Synonyms | 6-[4-(1-amino-3-hydroxycyclobutyl)phenyl]-1-ethyl-7-phenylpyrido[2,3-b][1,4]oxazin-2-one |
| Molecular Formula | C25H25N3O3 |
| Purity | ≥95% |
| IUPAC Name | 6-[4-(1-amino-3-hydroxycyclobutyl)phenyl]-1-ethyl-7-phenylpyrido[2,3-b][1,4]oxazin-2-one |
| InChI | InChI=1S/C25H25N3O3/c1-2-28-21-12-20(16-6-4-3-5-7-16)23(27-24(21)31-15-22(28)30)17-8-10-18(11-9-17)25(26)13-19(29)14-25/h3-12,19,29H,2,13-15,26H2,1H3 |
| InChIKey | BPHCAPAOSHZYJY-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)COC2=C1C=C(C(=N2)C3=CC=C(C=C3)C4(CC(C4)O)N)C5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
