For research use only. Not for therapeutic Use.
Aloeresin(CAT: R017485) refers to a group of naturally occurring phenolic compounds found in Aloe species, particularly in the resin of Aloe vera and other Aloe plants. These compounds, such as aloeresin A and aloeresin B, possess various pharmacological properties, including antioxidant, anti-inflammatory, and antimicrobial activities. Aloeresins are often studied for their potential therapeutic applications, such as wound healing, skin care, and protection against oxidative stress. Due to their bioactive properties, they are of interest in both traditional and modern medicinal research, particularly for developing natural health products.
CAS Number | 30861-27-9 |
Synonyms | Aloe Resin B; 8-β-D-Glucopyranosyl-7-hydroxy-5-methyl-2-(2-oxopropyl)-4H-1-benzopyran-4-one |
Molecular Formula | C19H22O9 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 7-hydroxy-5-methyl-2-(2-oxopropyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
InChI | InChI=1S/C19H22O9/c1-7-3-10(22)14(19-17(26)16(25)15(24)12(6-20)28-19)18-13(7)11(23)5-9(27-18)4-8(2)21/h3,5,12,15-17,19-20,22,24-26H,4,6H2,1-2H3/t12-,15-,16+,17-,19+/m1/s1 |
InChIKey | HKIKAXXIWJHWLY-ZIIYPAMZSA-N |
SMILES | CC1=CC(=C(C2=C1C(=O)C=C(O2)CC(=O)C)C3C(C(C(C(O3)CO)O)O)O)O |