For research use only. Not for therapeutic Use.
Aloin B, also known as barbaloin, is a naturally occurring anthraquinone glycoside found in the aloe plant, specifically in the latex. It is closely related to its isomer, aloin A. Aloin B is recognized for its laxative properties, stimulating bowel movements and commonly used in traditional medicine for treating constipation. It is also studied for potential antioxidant, anti-inflammatory, and antimicrobial activities. Aloin B is of interest in medicinal research and cosmetic formulations, contributing to skin health and digestive wellness.
| Catalog Number | I002963 |
| CAS Number | 28371-16-6 |
| Molecular Formula | C21H22O9 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | (10R)-1,8-dihydroxy-3-(hydroxymethyl)-10-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-10H-anthracen-9-one |
| InChI | InChI=1S/C21H22O9/c22-6-8-4-10-14(21-20(29)19(28)17(26)13(7-23)30-21)9-2-1-3-11(24)15(9)18(27)16(10)12(25)5-8/h1-5,13-14,17,19-26,28-29H,6-7H2/t13-,14-,17-,19+,20-,21+/m1/s1 |
| InChIKey | AFHJQYHRLPMKHU-WEZNYRQKSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C=C(C=C3C2C4C(C(C(C(O4)CO)O)O)O)CO)O |
