For research use only. Not for therapeutic Use.
Aloin（Cat No.:R065794）is a natural anthraquinone glycoside derived from the aloe plant, particularly Aloe vera, known for its strong laxative properties. It stimulates peristalsis in the intestines, making it effective in treating constipation. Aloin also exhibits antioxidant, anti-inflammatory, and antimicrobial activities, which have been explored in skincare and wound-healing applications. Its bitter taste has made it useful as a natural additive in bitters and certain medicinal preparations. However, long-term use is cautioned due to potential side effects, and it is typically studied for controlled, short-term therapeutic uses.
| Catalog Number | R065794 |
| CAS Number | 8015-61-0 |
| Synonyms | Barbaloin |
| Molecular Formula | C21H22O9 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,8-dihydroxy-3-(hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-10H-anthracen-9-one |
| InChI | InChI=1S/C21H22O9/c22-6-8-4-10-14(21-20(29)19(28)17(26)13(7-23)30-21)9-2-1-3-11(24)15(9)18(27)16(10)12(25)5-8/h1-5,13-14,17,19-26,28-29H,6-7H2 |
| InChIKey | AFHJQYHRLPMKHU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C2C4C(C(C(C(O4)CO)O)O)O)C=C(C=C3O)CO |
