For research use only. Not for therapeutic Use.
ALOX15-IN-1（Cat No.:I043908）is a selective inhibitor of the enzyme 15-lipoxygenase (ALOX15), which is involved in the metabolism of arachidonic acid into bioactive lipid mediators, such as leukotrienes and hydroxyeicosatetraenoic acids. These mediators play a role in inflammatory responses, immune cell activation, and various disease processes. By inhibiting ALOX15, ALOX15-IN-1 aims to reduce inflammation and could potentially be used to treat inflammatory disorders, such as asthma, cardiovascular diseases, and autoimmune conditions. Preclinical studies suggest that ALOX15-IN-1 may offer a targeted approach for managing chronic inflammation and related diseases.
| CAS Number | 2764818-24-6 |
| Synonyms | octyl N-[[5-(1H-indol-2-yl)-2-methoxyphenyl]sulfamoyl]carbamate |
| Molecular Formula | C24H31N3O5S |
| Purity | ≥95% |
| IUPAC Name | octyl N-[[5-(1H-indol-2-yl)-2-methoxyphenyl]sulfamoyl]carbamate |
| InChI | InChI=1S/C24H31N3O5S/c1-3-4-5-6-7-10-15-32-24(28)27-33(29,30)26-22-17-19(13-14-23(22)31-2)21-16-18-11-8-9-12-20(18)25-21/h8-9,11-14,16-17,25-26H,3-7,10,15H2,1-2H3,(H,27,28) |
| InChIKey | OMEJTIUQCWVECC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)NS(=O)(=O)NC1=C(C=CC(=C1)C2=CC3=CC=CC=C3N2)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
