For research use only. Not for therapeutic Use.
Aloxistatin（Cat No.:I005308）, also known as E-64d, is a potent, cell-permeable cysteine protease inhibitor, widely utilized in research for its ability to inhibit enzymes like cathepsins B, H, and L. By preventing the degradation of cellular components, Aloxistatin aids in studying protease functions in various biological processes, including autophagy and cell death. Its specificity for cysteine proteases makes it a valuable tool in studying diseases associated with excessive protease activity, such as cancer and neurodegenerative disorders. Aloxistatin’s stability and selectivity support its use in protease-related research and therapeutic exploration.
| Catalog Number | I005308 |
| CAS Number | 88321-09-9 |
| Synonyms | ethyl (2S,3S)-3-[[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylate |
| Molecular Formula | C17H30N2O5 |
| Purity | ≥95% |
| Target | Cathepsin |
| Solubility | DMSO: ≥ 23 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | ethyl (2S,3S)-3-[[(2S)-4-methyl-1-(3-methylbutylamino)-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylate |
| InChI | InChI=1S/C17H30N2O5/c1-6-23-17(22)14-13(24-14)16(21)19-12(9-11(4)5)15(20)18-8-7-10(2)3/h10-14H,6-9H2,1-5H3,(H,18,20)(H,19,21)/t12-,13-,14-/m0/s1 |
| InChIKey | SRVFFFJZQVENJC-IHRRRGAJSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H](O1)C(=O)N[C@@H](CC(C)C)C(=O)NCCC(C)C |
| Reference | <p style=/line-height:25px/> |
