For research use only. Not for therapeutic Use.
Alpertine（Cat No.:I013298）is a selective antagonist of the histamine H3 receptor, which plays a role in regulating neurotransmitter release and controlling various physiological functions, including sleep-wake cycles, appetite, and cognitive processes. By blocking the H3 receptor, alpertine can modulate the release of histamine and other neurotransmitters, potentially improving cognitive function, alertness, and memory. This makes it a promising candidate for treating conditions such as attention deficit hyperactivity disorder (ADHD), Alzheimer’s disease, and narcolepsy. Preclinical research suggests its neurogenic and cognitive-enhancing effects, but further studies are needed to determine its safety and clinical efficacy.
| Catalog Number | I013298 |
| CAS Number | 27076-46-6 |
| Synonyms | Alpertine |
| Molecular Formula | C₂₅H₃₁N₃O₄ |
| Purity | ≥95% |
| Target | Others |
| Solubility | DMSO |
| IUPAC Name | ethyl 5,6-dimethoxy-3-[2-(4-phenylpiperazin-1-yl)ethyl]-1H-indole-2-carboxylate |
| InChI | InChI=1S/C25H31N3O4/c1-4-32-25(29)24-19(20-16-22(30-2)23(31-3)17-21(20)26-24)10-11-27-12-14-28(15-13-27)18-8-6-5-7-9-18/h5-9,16-17,26H,4,10-15H2,1-3H3 |
| InChIKey | RXAVJRAUFOPBOO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC(=C(C=C2N1)OC)OC)CCN3CCN(CC3)C4=CC=CC=C4 |
| Reference | [1]. Matthews O. Bradley, et al. Fatty acid-antipsychotic compositions and uses thereof .US 5955459 A. |
