For research use only. Not for therapeutic Use.
Alpha-(1-Naphthyl)benzylamine(Cat No.:L031044)is a versatile compound used in pharmaceutical and chemical research, particularly in the synthesis of complex organic molecules. This amine derivative, featuring a naphthyl and benzyl group, serves as a key building block in the development of bioactive compounds, including potential therapeutic agents. Its unique structure allows for diverse chemical modifications, making it valuable in medicinal chemistry and drug discovery. With high purity and stability, alpha-(1-Naphthyl)benzylamine is essential for precise synthetic transformations, supporting advanced research in developing new drugs and chemical entities.
CAS Number | 2936-63-2 |
Molecular Formula | C17H15N |
Purity | ≥95% |
IUPAC Name | naphthalen-1-yl(phenyl)methanamine |
InChI | InChI=1S/C17H15N/c18-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16/h1-12,17H,18H2 |
InChIKey | MKYLPACDIKGXSW-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(C2=CC=CC3=CC=CC=C32)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |