For research use only. Not for therapeutic Use.
Alpha-(2-Bromophenyl)benzylamine(Cat No.:L031515)is a key intermediate used in the synthesis of pharmaceuticals and organic compounds. Its structure features a brominated phenyl ring and a benzylamine group, offering unique reactivity that is crucial for creating complex molecules. This compound is particularly valuable in the development of biologically active substances, where the bromine atom can participate in various chemical transformations, including cross-coupling reactions. Its versatility and stability make it an essential building block for researchers focused on drug discovery, fine chemicals, and advanced organic synthesis.
CAS Number | 55095-15-3 |
Molecular Formula | C13H12BrN |
Purity | ≥95% |
IUPAC Name | (2-bromophenyl)-phenylmethanamine |
InChI | InChI=1S/C13H12BrN/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9,13H,15H2 |
InChIKey | SPVWGVSMLZCEQX-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2Br)N |