For research use only. Not for therapeutic Use.
α-(4-Fluorophenyl)-4-(5-fluoro-2-pyrimidinyl)-1-piperazine butanol(CAT: M011968) is a complex heterocyclic compound featuring a piperazine ring substituted with a 4-fluorophenyl group and a 5-fluoro-2-pyrimidinyl moiety, along with a butanol side chain. This compound is primarily utilized in pharmaceutical research for the development of bioactive molecules, including receptor modulators and enzyme inhibitors. Its multifunctional structure allows for diverse interactions with biological targets, making it valuable for drug discovery and medicinal chemistry studies. With high purity and reliability, α-(4-Fluorophenyl)-4-(5-fluoro-2-pyrimidinyl)-1-piperazine butanol supports innovative research in the synthesis and evaluation of therapeutic candidates
CAS Number | 105565-56-8 |
Synonyms | alpha-(4-fluorophenyl)-4-(5-fluoro-2-pyrimidinyl)-1-piperazine butanol |
Molecular Formula | C18H22F2N4O |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | RT |
IUPAC Name | 1-(4-fluorophenyl)-4-[4-(5-fluoropyrimidin-2-yl)piperazin-1-yl]butan-1-ol |
InChI | InChI=1S/C18H22F2N4O/c19-15-5-3-14(4-6-15)17(25)2-1-7-23-8-10-24(11-9-23)18-21-12-16(20)13-22-18/h3-6,12-13,17,25H,1-2,7-11H2 |
InChIKey | ZXUYYZPJUGQHLQ-UHFFFAOYSA-N |
SMILES | C1CN(CCN1CCCC(C2=CC=C(C=C2)F)O)C3=NC=C(C=N3)F |