For research use only. Not for therapeutic Use.
Alpha-adenosine(Cat No.:I041269)is a purine nucleoside that plays a critical role in various physiological processes by interacting with adenosine receptors. It is an isomer of adenosine, specifically binding to the A1 receptors, which are involved in the regulation of heart rate, neurotransmission, and vascular tone. Alpha-adenosine has been investigated for its potential therapeutic applications in conditions such as arrhythmias, stroke, and neurodegenerative diseases. It may exert protective effects by reducing inflammation and promoting vasodilation. Due to its specific receptor interaction, alpha-adenosine offers promise for targeted treatment strategies in cardiovascular and neurological disorders.
CAS Number | 5682-25-7 |
Synonyms | (2S,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
Molecular Formula | C10H13N5O4 |
Purity | ≥95% |
IUPAC Name | (2S,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
InChI | InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10+/m1/s1 |
InChIKey | OIRDTQYFTABQOQ-CRKDRTNXSA-N |
SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |