For research use only. Not for therapeutic Use.
Alpha-Asarone（Cat No.:I002993）is a naturally occurring compound found in the essential oil of certain plants, particularly in the rhizomes of Acorus calamus (sweet flag). It is a member of the phenylpropanoid class and is known for its distinct aromatic properties. Alpha-asarone has been studied for its potential pharmacological effects, including antioxidant, anti-inflammatory, and neuroprotective activities. It is also investigated for its possible applications in traditional medicine, such as in improving cognitive function and alleviating anxiety. However, its safety profile and potential toxicity, especially in long-term use, require further research.
| CAS Number | 2883-98-9 |
| Synonyms | trans-Asarone |
| Molecular Formula | C12H16O3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | 1,2,4-trimethoxy-5-[(E)-prop-1-enyl]benzene |
| InChI | InChI=1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3/b6-5+ |
| InChIKey | RKFAZBXYICVSKP-AATRIKPKSA-N |
| SMILES | C/C=C/C1=CC(=C(C=C1OC)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
