Alpha-Bisabolol (Cat No.:I018741) is a natural monocyclic sesquiterpene alcohol found in chamomile essential oil. It is widely used in the cosmetic and personal care industry. Alpha-Bisabolol possesses numerous beneficial properties, including anti-inflammatory, antioxidant, and antimicrobial effects. It is known for its soothing and calming effects on the skin, reducing redness, inflammation, and irritation. This compound is frequently incorporated into skincare products, such as creams, lotions, and serums, to promote skin health, rejuvenation, and provide gentle care for sensitive or irritated skin.
| Catalog Number | I018741 |
| CAS Number | 515-69-5 |
| Molecular Formula | C₁₅H₂₆O |
| Purity | ≥95% |
| IUPAC Name | (2R)-6-methyl-2-[(1R)-4-methylcyclohex-3-en-1-yl]hept-5-en-2-ol |
| InChI | InChI=1S/C15H26O/c1-12(2)6-5-11-15(4,16)14-9-7-13(3)8-10-14/h6-7,14,16H,5,8-11H2,1-4H3/t14-,15+/m0/s1 |
| InChIKey | RGZSQWQPBWRIAQ-LSDHHAIUSA-N |
| SMILES | CC1=CCC(CC1)C(C)(CCC=C(C)C)O |
