For research use only. Not for therapeutic Use.
alpha-Chloro-4-(tert-pentyl)toluene(Cat No.:L007085), is an organic compound featuring a chloro group (-Cl) attached to the alpha carbon of a toluene ring substituted with a tert-pentyl group (-C(CH3)3) at the 4-position. This compound is used in chemical research and synthesis, often as a starting material for various organic transformations. Its unique structure allows for diverse chemical modifications, enabling the creation of complex molecules. Researchers utilize alpha-chloro-4-(tert-pentyl)toluene as a building block to develop new compounds for applications in pharmaceuticals, agrochemicals, and materials science, contributing significantly to advancements in organic chemistry.
CAS Number | 28162-11-0 |
Molecular Formula | C12H17Cl |
Purity | ≥95% |
IUPAC Name | 1-(chloromethyl)-4-(2-methylbutan-2-yl)benzene |
InChI | InChI=1S/C12H17Cl/c1-4-12(2,3)11-7-5-10(9-13)6-8-11/h5-8H,4,9H2,1-3H3 |
InChIKey | GZSVKIJGGVPFGX-UHFFFAOYSA-N |
SMILES | CCC(C)(C)C1=CC=C(C=C1)CCl |