For research use only. Not for therapeutic Use.
Alpha-Estradiol-d2(Cat No.:S000512) is a deuterated form of alpha-estradiol, replacing two hydrogen atoms with deuterium. Alpha-estradiol, a naturally occurring estrogen, plays a crucial role in the regulation of reproductive and secondary sexual characteristics. The substitution with deuterium in alpha-Estradiol-d2 increases the molecule’s metabolic stability, making it valuable for pharmacokinetic and metabolic studies. This enhanced stability allows researchers to more accurately study estrogen’s behavior in biological systems, such as its absorption, distribution, metabolism, and excretion.
CAS Number | 81586-94-9 |
Molecular Formula | C18H22D2O2 |
Purity | ≥95% |
Target | 5 alpha Reductase |
IUPAC Name | (8R,9S,13S,14S,17R)-2,4-dideuterio-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17-,18+/m1/s1/i3D,10D |
InChIKey | VOXZDWNPVJITMN-BHOSFUFTSA-N |
SMILES | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O |