For research use only. Not for therapeutic Use.
Alpha-thujone(CAT: R072414) is a monoterpene ketone found in plants like Artemisia absinthium (wormwood) and sage. It is known for its role as the psychoactive component in absinthe, where it acts as a GABA-A receptor antagonist, reducing inhibitory neurotransmission and leading to excitatory effects. α-Thujone has been studied for its potential neurotoxic, convulsant, and insecticidal properties. While toxic at high doses, its biological activity makes it valuable for research into neurostimulation, seizure mechanisms, and natural pest control, offering insights into both pharmacology and toxicology.
CAS Number | 546-80-5 |
Molecular Formula | C10H16O |
Purity | ≥95% |
IUPAC Name | (1S,4R,5R)-4-methyl-1-propan-2-ylbicyclo[3.1.0]hexan-3-one |
InChI | InChI=1S/C10H16O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-8H,4-5H2,1-3H3/t7-,8-,10+/m1/s1 |
InChIKey | USMNOWBWPHYOEA-MRTMQBJTSA-N |
SMILES | CC1C2CC2(CC1=O)C(C)C |