For research use only. Not for therapeutic Use.
Alpha-(trichloromethyl)-4-pyridineethanol(Cat No.:M122503) is a chemical compound used in various applications, including organic synthesis and chemical research. Its mode of action involves serving as a trichloromethylating agent, where the trichloromethyl group (-CCl3) is introduced to specific molecules or reactions. This compound exhibits pharmacologic actions that are of interest in the development of novel pharmaceuticals and biologically active substances. Due to its unique properties, it finds applications in diverse fields, such as medicinal chemistry and materials science.
| Catalog Number | M122503 |
| CAS Number | 10129-56-3 |
| Synonyms | 1,1,1-trichloro-3-pyridin-4-ylpropan-2-ol |
| Molecular Formula | C8H8Cl3NO |
| Purity | ≥95% |
| Target | Caspase |
| Solubility | Soluble to 50 mM in 1eq. HCl |
| Storage | Store at RT |
| IUPAC Name | 1,1,1-trichloro-3-pyridin-4-ylpropan-2-ol |
| InChI | InChI=1S/C8H8Cl3NO/c9-8(10,11)7(13)5-6-1-3-12-4-2-6/h1-4,7,13H,5H2 |
| InChIKey | NGTDJJKTGRNNAU-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1CC(C(Cl)(Cl)Cl)O |
