For research use only. Not for therapeutic Use.
ALPK1-IN-3 is an inhibitor of ALPK1 extracted from patent WO2022063153A1 compound T007. ALPK1-IN-3 inhibits kidney proinflammatory gene expression and improves the survival rate of the animals in sepsis induced acute kidney injury animal model[1]. ALPK1-IN-3 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Catalog Number | I040876 |
| CAS Number | 2765633-73-4 |
| Synonyms | N-(4-ethynyl-1,3-benzothiazol-2-yl)-2,6-difluoro-4-piperazin-1-ylbenzamide |
| Molecular Formula | C20H16F2N4OS |
| Purity | ≥95% |
| InChI | InChI=1S/C20H16F2N4OS/c1-2-12-4-3-5-16-18(12)24-20(28-16)25-19(27)17-14(21)10-13(11-15(17)22)26-8-6-23-7-9-26/h1,3-5,10-11,23H,6-9H2,(H,24,25,27) |
| InChIKey | SYFBCXSTGKUMAJ-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C(=CC=C1)SC(=N2)NC(=O)C3=C(C=C(C=C3F)N4CCNCC4)F |
| Reference | [1]. Danyang Liu, et.al. Benzothiazole and quinoline derivatives and their use. |
