For research use only. Not for therapeutic Use.
Alprenolol（Cat No.:I001408）is a non-selective beta-adrenergic receptor antagonist (beta-blocker) used primarily in the treatment of cardiovascular conditions such as hypertension, angina pectoris, and arrhythmias. It works by blocking the action of adrenaline and other stress hormones on the heart and blood vessels, thereby reducing heart rate and blood pressure. Alprenolol also has intrinsic sympathomimetic activity, meaning it can mildly stimulate beta receptors while blocking them, reducing the risk of excessive bradycardia. It is valuable in clinical settings for managing heart-related conditions and improving cardiovascular health.
| Catalog Number | I001408 |
| CAS Number | 13655-52-2 |
| Synonyms | 1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol |
| Molecular Formula | C15H23NO2 |
| Purity | ≥95% |
| IUPAC Name | 1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ol |
| InChI | InChI=1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3 |
| InChIKey | PAZJSJFMUHDSTF-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=CC=C1CC=C)O |
