For research use only. Not for therapeutic Use.
ALPS (N-Ethyl-N-sulfopropylaniline sodium salt)(CAT: I013909) is a water-soluble aniline derivative widely used as a dye intermediate and in photometric analysis. Its unique sulfonate group enhances solubility, making it suitable for aqueous systems and industrial applications. ALPS is commonly employed in the synthesis of colorants and in the study of reaction mechanisms involving sulfonated aromatic compounds. With its high purity and consistent performance, this compound is an essential reagent for chemical research, dye manufacturing, and analytical methodologies in various scientific and industrial domains.
CAS Number | 82611-85-6 |
Molecular Formula | C₁₁H₁₆NNaO₃S |
Purity | ≥95% |
Target | Dye Reagents |
Solubility | 10 mM in DMSO |
IUPAC Name | sodium;3-(N-ethylanilino)propane-1-sulfonate |
InChI | InChI=1S/C11H17NO3S.Na/c1-2-12(9-6-10-16(13,14)15)11-7-4-3-5-8-11;/h3-5,7-8H,2,6,9-10H2,1H3,(H,13,14,15);/q;+1/p-1 |
InChIKey | FFJBIXKLISICDT-UHFFFAOYSA-M |
SMILES | CCN(CCCS(=O)(=O)[O-])C1=CC=CC=C1.[Na+] |