For research use only. Not for therapeutic Use.
Alternariol monomethyl ether(Cat No.:R065944)is a mycotoxin produced by the Alternaria species, commonly found in crops like tomatoes, wheat, and corn. It exhibits cytotoxic, genotoxic, and carcinogenic properties, making it a concern in food safety. Due to its mutagenic potential, it has been studied for its effects on DNA and cell division, particularly in relation to its role in cancer development. Research continues to assess its environmental impact and potential as a biomarker for fungal contamination. Analytical methods focus on its detection and quantification in food products.
CAS Number | 23452-05-3 |
Synonyms | AME;NSC 638262 |
Molecular Formula | C15H12O5 |
Purity | ≥95% |
Target | Antibiotic |
Storage | -20°C |
IUPAC Name | 3,7-dihydroxy-9-methoxy-1-methylbenzo[c]chromen-6-one |
InChI | InChI=1S/C15H12O5/c1-7-3-8(16)4-12-13(7)10-5-9(19-2)6-11(17)14(10)15(18)20-12/h3-6,16-17H,1-2H3 |
InChIKey | LCSDQFNUYFTXMT-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC2=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |