For research use only. Not for therapeutic Use.
Alterporriol B is a biochemical.
| Catalog Number | I021858 |
| CAS Number | 88901-69-3 |
| Synonyms | Alterporriol B |
| Molecular Formula | C32H26O13 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (1,1'-Bianthracene)-9,9',10,10'-tetrone, 5,6,7,8-tetrahydro-4,4',5,6,6',7,8-heptahydroxy-2,2'-dimethoxy-7,7'-dimethyl-, (5S-(5alpha,6beta,7beta,8alpha))- |
| InChI | InChI=1S/C32H26O13/c1-9-5-10-11(6-12(9)33)25(36)17-13(34)7-15(44-3)19(21(17)26(10)37)20-16(45-4)8-14(35)18-22(20)28(39)24-23(27(18)38)29(40)31(42)32(2,43)30(24)41/h5-8,29-31,33-35,40-43H,1-4H3/t29-,30+,31+,32-/m0/s1 |
| InChIKey | YHXUFRJJYFYRSH-BVEPWEIPSA-N |
| SMILES | O=C1C2=C([C@H](O)[C@@H](O)[C@@](C)(O)[C@@H]2O)C(C3=C(O)C=C(OC)C(C(C(OC)=CC(O)=C4C(C5=C6C=C(C)C(O)=C5)=O)=C4C6=O)=C13)=O |
| Reference | 1: Debbab A, Aly AH, Edrada-Ebel R, Wray V, Müller WE, Totzke F, Zirrgiebel U, Schächtele C, Kubbutat MH, Lin WH, Mosaddak M, Hakiki A, Proksch P, Ebel R. Bioactive metabolites from the endophytic fungus Stemphylium globuliferum isolated from Mentha pulegium. J Nat Prod. 2009 Apr;72(4):626-31. doi: 10.1021/np8004997. PubMed PMID: 19271717. |
