For research use only. Not for therapeutic Use.
AM-2394(CAT: I001705) is a glucokinase activator (GKA) that exhibits structural uniqueness compared to other GKAs. Glucokinase is an enzyme involved in glucose metabolism and plays a crucial role in regulating blood glucose levels. AM-2394 specifically activates glucokinase, leading to increased glucose uptake and utilization in the liver. This activation can potentially improve glucose control in individuals with conditions such as type 2 diabetes. AM-2394’s unique chemical structure and selective activation of glucokinase make it a promising candidate for the development of novel therapies for diabetes and related metabolic disorders.
| Catalog Number | I001705 |
| CAS Number | 1442684-77-6 |
| Synonyms | N-[6/’-(2-hydroxy-2-methylpropoxy)-4-[(5-methyl-3-pyridinyl)oxy][3,3/’-bipyridin]-6-yl]-N/’-methyl-urea |
| Molecular Formula | C22H25N5O4 |
| Purity | ≥95% |
| Target | 60 nM (glucokinase)[1] |
| Solubility | DMSO: ≥ 30 mg/mL |
| Storage | -20°C |
| IUPAC Name | 1-[5-[6-(2-hydroxy-2-methylpropoxy)pyridin-3-yl]-4-(5-methylpyridin-3-yl)oxypyridin-2-yl]-3-methylurea |
| InChI | InChI=1S/C22H25N5O4/c1-14-7-16(11-24-9-14)31-18-8-19(27-21(28)23-4)25-12-17(18)15-5-6-20(26-10-15)30-13-22(2,3)29/h5-12,29H,13H2,1-4H3,(H2,23,25,27,28) |
| InChIKey | QUISANLDBDCMPD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1)OC2=CC(=NC=C2C3=CN=C(C=C3)OCC(C)(C)O)NC(=O)NC |
| Reference | 1:ACS Med Chem Lett. 2016 May 23;7(7):714-8. doi: 10.1021/acsmedchemlett.6b00140. eCollection 2016 Jul 14. Novel Series of Potent Glucokinase Activators Leading to the Discovery of AM-2394.Dransfield PJ,Pattaropong V,Lai S,Fu Z,Kohn TJ,Du X,Cheng A,Xiong Y,Komorowski R,Jin L,Conn M,Tien E,DeWolf WE Jr,Hinklin RJ,Aicher TD,Kraser CF,Boyd SA,Voegtli WC,Condroski KR,Veniant-Ellison M,Medina JC,Houze J,Coward P, PMID: 27437083 PMCID: PMC4948016 [Available on 2017-07-14] DOI: 10.1021/acsmedchemlett.6b00140 </br><span>Abstract:</span> Glucokinase (GK) catalyzes the phosphorylation of glucose to glucose-6-phosphate. We present the structure-activity relationships leading to the discovery of AM-2394, a structurally distinct GKA. AM-2394 activates GK with an EC50 of 60 nM, increases the affinity of GK for glucose by approximately 10-fold, exhibits moderate clearance and good oral bioavailability in multiple animal models, and lowers glucose excursion following an oral glucose tolerance test in an ob/ob mouse model of diabetes. |
