For research use only. Not for therapeutic Use.
AM-Imidazole-PA-Boc is an alkyl chain-based PROTAC linker can be used in the synthesis of PROTAC IRAK4 degrader-1 (HY-129966)[1].
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
| Catalog Number | I017556 |
| CAS Number | 2357108-99-5 |
| Synonyms | tert-butyl N-[3-[4-(aminomethyl)imidazol-1-yl]propyl]carbamate |
| Molecular Formula | C12H22N4O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C12H22N4O2/c1-12(2,3)18-11(17)14-5-4-6-16-8-10(7-13)15-9-16/h8-9H,4-7,13H2,1-3H3,(H,14,17) |
| InChIKey | BQENGFIYJNRYFS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCN1C=C(N=C1)CN |
| Reference | [1]. Nello Mainolfi, et al. Irak degraders and uses thereof. US20190192668A1. |
