For research use only. Not for therapeutic Use.
Amantadine-d15(Cat No.:S000533) is a deuterated version of amantadine, where fifteen hydrogen atoms are replaced with deuterium, increasing the molecular stability and altering its kinetic properties. Amantadine is primarily used as an antiviral agent against influenza A and as a medication for Parkinson’s disease and drug-induced extrapyramidal reactions. The deuterated form, amantadine-d15, is particularly valuable in pharmacological research, allowing scientists to study the drug’s metabolic pathways and degradation processes more precisely.
Catalog Number | S000533 |
CAS Number | 33830-10-3 |
Molecular Formula | C10H2D15N |
Purity | ≥95% |
IUPAC Name | 2,2,3,4,4,5,6,6,7,8,8,9,9,10,10-pentadecadeuterioadamantan-1-amine |
InChI | InChI=1S/C10H17N/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6,11H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D,8D,9D |
InChIKey | DKNWSYNQZKUICI-BXSQCBKHSA-N |
SMILES | C1C2CC3CC1CC(C2)(C3)N |