For research use only. Not for therapeutic Use.
Ambazone（Cat No.:R051876）is an organic compound used primarily as a synthetic intermediate in chemical research and manufacturing. It has shown potential as a reagent in various chemical reactions, particularly in the synthesis of other organic compounds. Ambazone has been explored for its antimicrobial properties, with some studies indicating activity against certain bacterial strains. However, its primary applications are in research and the development of pharmaceutical compounds. Further studies are required to fully understand its biological activity, safety profile, and potential therapeutic uses in medical and industrial settings.
| CAS Number | 539-21-9 |
| Synonyms | [4-[2-(diaminomethylidene)hydrazinyl]phenyl]iminothiourea |
| Molecular Formula | C8H11N7S |
| Purity | ≥95% |
| IUPAC Name | [4-[2-(diaminomethylidene)hydrazinyl]phenyl]iminothiourea |
| InChI | InChI=1S/C8H11N7S/c9-7(10)14-12-5-1-3-6(4-2-5)13-15-8(11)16/h1-4,12H,(H2,11,16)(H4,9,10,14) |
| InChIKey | ANZIOUQAFBXNHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NN=C(N)N)N=NC(=S)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
