For research use only. Not for therapeutic Use.
Ambroxol (Cat.No:I002415) is a medication used for the treatment of respiratory diseases such as bronchitis, pneumonia, and chronic obstructive pulmonary disease (COPD). It works by thinning mucus and making it easier to cough up, which helps to clear the airways. Ambroxol is available in various formulations, including tablets, syrups, and inhalers.
| Catalog Number | I002415 |
| CAS Number | 18683-91-5 |
| Synonyms | NA 872 |
| Molecular Formula | C13H18Br2N2O |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexan-1-ol |
| InChI | InChI=1S/C13H18Br2N2O/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10/h5-6,10-11,17-18H,1-4,7,16H2 |
| InChIKey | JBDGDEWWOUBZPM-XYPYZODXSA-N |
| SMILES | C1CC(CCC1NCC2=C(C(=CC(=C2)Br)Br)N)O |
| Reference | <p style=/line-height:25px/> |
