For research use only. Not for therapeutic Use.
Ambucetamide is a pharmaceutical compound used as a smooth muscle relaxant and antispasmodic agent. It is effective in treating conditions such as muscle cramps, gastrointestinal spasms, and urinary tract disorders. Known for its efficacy and safety profile, Ambucetamide improves patient comfort and quality of life by alleviating painful muscle contractions and associated symptoms in clinical settings.
| Catalog Number | R024692 |
| CAS Number | 519-88-0 |
| Synonyms | (±)-Ambucetamide; 2-(Di-n-butylamino)-2-(4-methoxyphenyl)acetamide; 2-(Di-n-butylamino)-2-(p-methoxyphenyl)acetamide; 2-(Dibutylamino)-2-(p-methoxyphenyl)acetamide; A 16; Bersen; Dibutamide; Meritin; R 5; α-Dibutylamino-α-(p-methoxyphenyl)acetamide; |
| Molecular Formula | C17H28N2O2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-(dibutylamino)-2-(4-methoxyphenyl)acetamide |
| InChI | InChI=1S/C17H28N2O2/c1-4-6-12-19(13-7-5-2)16(17(18)20)14-8-10-15(21-3)11-9-14/h8-11,16H,4-7,12-13H2,1-3H3,(H2,18,20) |
| InChIKey | WUSAVCGXMSWMQM-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)C(C1=CC=C(C=C1)OC)C(=O)N |
