For research use only. Not for therapeutic Use.
AMD 3465 hexahydrobromide(Cat No.:I002397)is a potent and selective antagonist of the chemokine receptor CXCR4, which plays a crucial role in various physiological processes, including immune response and cancer metastasis. By blocking CXCR4, AMD 3465 interferes with the migration and proliferation of cancer cells, making it a potential therapeutic candidate for treating hematological malignancies and solid tumors. Additionally, its ability to modulate immune responses positions it as a valuable agent in addressing conditions like HIV and autoimmune diseases. Ongoing research is exploring its efficacy and safety in clinical settings, highlighting its promise in oncology and immunotherapy.
CAS Number | 185991-07-5 |
Synonyms | N-(4-((1,4,8,11-tetraazacyclotetradecan-1-yl)methyl)benzyl)-1-(pyridin-2-yl)methanamine |
Molecular Formula | C24H38N6 • 6HBr |
Purity | ≥95% |
Target | Immunology/Inflammation |
Solubility | H2O: ≥ 38 mg/mL |
Storage | Store at -20°C |
IUPAC Name | N-(pyridin-2-ylmethyl)-1-[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phenyl]methanamine;hexahydrobromide |
InChI | InChI=1S/C24H38N6.6BrH/c1-2-13-29-24(5-1)20-28-19-22-6-8-23(9-7-22)21-30-17-4-12-26-15-14-25-10-3-11-27-16-18-30;;;;;;/h1-2,5-9,13,25-28H,3-4,10-12,14-21H2;6*1H |
InChIKey | ARHBIBDGWDRBJH-UHFFFAOYSA-N |
SMILES | C1CNCCNCCCN(CCNC1)CC2=CC=C(C=C2)CNCC3=CC=CC=N3.Br.Br.Br.Br.Br.Br |
Reference | <p style=/line-height:25px/> |