For research use only, not for therapeutic use.
AMD 3465（Cat No.:I002398）is a potent and selective antagonist of the CXCR4 chemokine receptor, which plays a crucial role in immune cell trafficking, cancer metastasis, and HIV infection. By blocking the interaction between CXCR4 and its natural ligand, stromal cell-derived factor-1 (SDF-1), AMD 3465 inhibits processes like cancer cell migration, metastasis, and viral entry in HIV-1. It has been studied as a potential therapeutic agent in oncology for its anti-metastatic effects and in HIV research as a means to prevent viral replication. Its targeted action makes it a valuable tool in CXCR4-related disease research.
| Catalog Number | I002398 |
| CAS Number | 185991-24-6 |
| Synonyms | N-(pyridin-2-ylmethyl)-1-[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phenyl]methanamine |
| Molecular Formula | C24H38N6 |
| Purity | ≥95% |
| Target | CXCR |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20C |
| IUPAC Name | N-(pyridin-2-ylmethyl)-1-[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phenyl]methanamine |
| InChI | InChI=1S/C24H38N6/c1-2-13-29-24(5-1)20-28-19-22-6-8-23(9-7-22)21-30-17-4-12-26-15-14-25-10-3-11-27-16-18-30/h1-2,5-9,13,25-28H,3-4,10-12,14-21H2 |
| InChIKey | CWJJHESJXJQCJA-UHFFFAOYSA-N |
| SMILES | C1CNCCNCCCN(CCNC1)CC2=CC=C(C=C2)CNCC3=CC=CC=N3 |
