For research use only. Not for therapeutic Use.
Amebucort (CAT: I013277) is a synthetic glucocorticoid corticosteroid that exhibits anti-inflammatory and immunosuppressive properties. As a glucocorticoid receptor agonist, amebucort binds to and activates the glucocorticoid receptor, leading to the regulation of gene expression and modulation of various inflammatory pathways. It is commonly used in research studies to investigate the mechanisms of inflammatory disorders and to evaluate the potential therapeutic effects of glucocorticoids in managing inflammation-related conditions. Amebucort’s anti-inflammatory properties make it a valuable tool for understanding and developing treatments for inflammatory diseases.
| Catalog Number | I013277 |
| CAS Number | 83625-35-8 |
| Synonyms | UNII-7YRF8G0G0F; 7YRF8G0G0F; 11 Beta,17,21-Trihydroxy-6 alpha-methylpregn-4-ene-3,20-dione 21-acetate 17-butyrate |
| Molecular Formula | C28H40O7 |
| Purity | ≥95% |
| Target | Glucocorticoid Receptor |
| Solubility | DMSO |
| IUPAC Name | [(6S,8S,9S,10R,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-11-hydroxy-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] butanoate |
| InChI | InChI=1S/C28H40O7/c1-6-7-24(33)35-28(23(32)15-34-17(3)29)11-9-20-19-12-16(2)21-13-18(30)8-10-26(21,4)25(19)22(31)14-27(20,28)5/h13,16,19-20,22,25,31H,6-12,14-15H2,1-5H3/t16-,19-,20-,22-,25+,26-,27-,28-/m0/s1 |
| InChIKey | QRRVOCXLQYLNEC-PPJDWOAVSA-N |
| SMILES | CCCC(=O)OC1(CCC2C1(CC(C3C2CC(C4=CC(=O)CCC34C)C)O)C)C(=O)COC(=O)C |
| Reference | [1]. Methods and reagents for the treatment of inflammatory disorders. US20050187200A1 |
