For research use only. Not for therapeutic Use.
Amedalin is a biochemical.
| Catalog Number | I021945 |
| CAS Number | 22136-26-1 |
| Synonyms | Amedalin |
| Molecular Formula | C19H22N2O |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (S)-3-methyl-3-(3-(methylamino)propyl)-1-phenylindolin-2-one |
| InChI | InChI=1S/C19H22N2O/c1-19(13-8-14-20-2)16-11-6-7-12-17(16)21(18(19)22)15-9-4-3-5-10-15/h3-7,9-12,20H,8,13-14H2,1-2H3/t19-/m0/s1 |
| InChIKey | HBGWAZBZXJBYQD-IBGZPJMESA-N |
| SMILES | CNCCC[C@]1(C)C(=O)N(c2ccccc2)c3ccccc13 |
