For research use only. Not for therapeutic Use.
Amedalin（Cat No.:I021945）is an experimental small molecule compound being investigated for its potential therapeutic applications in cancer treatment. It is known to target specific pathways involved in tumor growth and metastasis, potentially inhibiting cancer cell proliferation and survival. Amedalin works by interfering with key proteins or enzymes that drive malignancy, making it a candidate for use in treating various types of cancers. Ongoing research aims to evaluate its efficacy in preclinical models and determine its safety, pharmacokinetics, and potential for clinical use as a part of targeted cancer therapies.
| Catalog Number | I021945 |
| CAS Number | 22136-26-1 |
| Synonyms | Amedalin |
| Molecular Formula | C19H22N2O |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (S)-3-methyl-3-(3-(methylamino)propyl)-1-phenylindolin-2-one |
| InChI | InChI=1S/C19H22N2O/c1-19(13-8-14-20-2)16-11-6-7-12-17(16)21(18(19)22)15-9-4-3-5-10-15/h3-7,9-12,20H,8,13-14H2,1-2H3/t19-/m0/s1 |
| InChIKey | HBGWAZBZXJBYQD-IBGZPJMESA-N |
| SMILES | CNCCC[C@]1(C)C(=O)N(c2ccccc2)c3ccccc13 |
