For research use only. Not for therapeutic Use.
Amentoflavone(Cat No.:I002070) is a naturally occurring biflavone compound that possesses various biological properties. It exhibits anti-inflammatory activity by modulating inflammatory pathways and reducing the production of inflammatory mediators. Amentoflavone also displays potent antioxidative effects, protecting cells from oxidative stress and damage. Additionally, it shows neuroprotective properties by promoting neuronal survival and preventing neurodegeneration. The diverse range of biological activities exhibited by amentoflavone makes it a valuable compound for potential therapeutic applications in inflammation-related disorders, oxidative stress-related conditions, and neurodegenerative diseases.
CAS Number | 1617-53-4 |
Synonyms | Didemethyl Ginkgetin;NSC 295677;Tridemethylsciadopitysin |
Molecular Formula | C30H18O10 |
Purity | ≥95% |
Target | NF-κB |
Solubility | DMSO: ≥ 34 mg/mL |
Storage | 2-8°C |
IUPAC Name | 8-[5-(5,7-dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
InChI | InChI=1S/C30H18O10/c31-15-4-1-13(2-5-15)24-12-23(38)29-21(36)10-20(35)27(30(29)40-24)17-7-14(3-6-18(17)33)25-11-22(37)28-19(34)8-16(32)9-26(28)39-25/h1-12,31-36H |
InChIKey | YUSWMAULDXZHPY-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4=C(C=CC(=C4)C5=CC(=O)C6=C(C=C(C=C6O5)O)O)O)O |