For research use only. Not for therapeutic Use.
Amezinium methylsulfate（Cat No.:I003077）is a sympathomimetic drug primarily used as a vasopressor to treat hypotension (low blood pressure), particularly in cases of shock or during anesthesia. It works by stimulating alpha-adrenergic receptors, leading to vasoconstriction and an increase in blood pressure. Amezinium also has mild central nervous system stimulating effects, which may contribute to its ability to increase heart rate and blood flow. It is typically administered intravenously in clinical settings. Side effects may include tachycardia, headache, and elevated blood pressure, and its use is carefully monitored due to potential cardiovascular risks.
| Catalog Number | I003077 |
| CAS Number | 30578-37-1 |
| Molecular Formula | C12H15N3O5S |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | DMSO: ≥ 34 mg/mL |
| Storage | 3 years -20C powder |
| IUPAC Name | 6-methoxy-1-phenylpyridazin-1-ium-4-amine;methyl sulfate |
| InChI | InChI=1S/C11H11N3O.CH4O4S/c1-15-11-7-9(12)8-13-14(11)10-5-3-2-4-6-10;1-5-6(2,3)4/h2-8,12H,1H3;1H3,(H,2,3,4) |
| InChIKey | ZEASXVYVFFXULL-UHFFFAOYSA-N |
| SMILES | COC1=[N+](N=CC(=C1)N)C2=CC=CC=C2.COS(=O)(=O)[O-] |
| Reference | </br>1:Leg ulceration during amezinium methylsulfate therapy for hypotension in a hemodialyzed patient with generalized vascular calcification. Kitano Y, Nomura S, Saiki T, Osawa G.Nephron. 1995;71(1):115. No abstract available. PMID: 8538837 </br>2:[Therapeutic use of amezinium methylsulfate–a new, long acting, sympathomimetic–in paraspinal conduction anesthesia]. Schaps D, Seitz W, Mehler D, Tholen A, Goroll D.Anasth Intensivther Notfallmed. 1984 Oct;19(5):235-9. German. PMID: 6517242 |
