For research use only. Not for therapeutic Use.
Amicetin-A(Cat No.:M085502) is a natural compound that belongs to the family of nucleoside antibiotics, which are known for their role in inhibiting bacterial growth and protein synthesis. It specifically targets and interferes with bacterial ribosomes, the cellular machinery responsible for protein production. Amicetin-A’s mode of action is similar to that of other nucleoside antibiotics, making it a potential candidate for treating antibiotic-resistant bacterial infections.
Catalog Number | M085502 |
CAS Number | 17650-86-1 |
Molecular Formula | C29H42N6O9 |
Purity | ≥95% |
Target | Antibiotic |
Storage | -80°C |
IUPAC Name | 4-[[(2S)-2-amino-3-hydroxy-2-methylpropanoyl]amino]-N-[1-[(2R,5S,6R)-5-[(2R,3R,4S,5S,6R)-5-(dimethylamino)-3,4-dihydroxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
InChI | InChI=1S/C29H42N6O9/c1-15-19(44-26-24(38)23(37)22(34(4)5)16(2)43-26)10-11-21(42-15)35-13-12-20(33-28(35)41)32-25(39)17-6-8-18(9-7-17)31-27(40)29(3,30)14-36/h6-9,12-13,15-16,19,21-24,26,36-38H,10-11,14,30H2,1-5H3,(H,31,40)(H,32,33,39,41)/t15-,16-,19+,21-,22-,23+,24-,26-,29+/m1/s1 |
InChIKey | HDNVYHWHCVTDIV-ZENIWSRCSA-N |
SMILES | CC1C(CCC(O1)N2C=CC(=NC2=O)NC(=O)C3=CC=C(C=C3)NC(=O)C(C)(CO)N)OC4C(C(C(C(O4)C)N(C)C)O)O |