For research use only. Not for therapeutic Use.
Amikacin Sulfate（Cat No.:I003453）is a broad-spectrum aminoglycoside antibiotic effective against a wide range of gram-negative bacteria, including strains resistant to other aminoglycosides. It works by binding to the bacterial 30S ribosomal subunit, inhibiting protein synthesis and leading to cell death. Commonly used for severe infections such as respiratory, urinary, and bloodstream infections, Amikacin Sulfate is also significant in research on multidrug-resistant bacteria and antibiotic efficacy. Its stability and potency make it ideal for developing treatments against resistant pathogens and advancing studies in antimicrobial resistance mechanisms.
| Catalog Number | I003453 |
| CAS Number | 39831-55-5 |
| Molecular Formula | C22H43N5O13.2H2O4S |
| Purity | ≥95% |
| Target | Antibacterial |
| Solubility | H2O: ＞ 50 mg/mL |
| Storage | 3 years -20℃ powder |
| IUPAC Name | (2S)-4-amino-N-[(1R,2S,3S,4R,5S)-5-amino-2-[(2S,3R,4S,5S,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2R,3R,4S,5S,6R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxycyclohexyl]-2-hydroxybutanamide;sulfuric acid |
| InChI | InChI=1S/C22H43N5O13.2H2O4S/c23-2-1-8(29)20(36)27-7-3-6(25)18(39-22-16(34)15(33)13(31)9(4-24)37-22)17(35)19(7)40-21-14(32)11(26)12(30)10(5-28)38-21;2*1-5(2,3)4/h6-19,21-22,28-35H,1-5,23-26H2,(H,27,36);2*(H2,1,2,3,4)/t6-,7+,8-,9+,10+,11-,12+,13+,14+,15-,16+,17-,18+,19-,21+,22+;;/m0../s1 |
| InChIKey | FXKSEJFHKVNEFI-GCZBSULCSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1NC(=O)[C@H](CCN)O)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)N)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CN)O)O)O)N.OS(=O)(=O)O.OS(=O)(=O)O |
| Reference | <p style=/line-height:25px/> </p> |
