For research use only. Not for therapeutic Use.
Amiloride-15N3 is a nitrogen-15 labeled diuretic used in advanced pharmaceutical and biochemical research. This compound, enriched with three nitrogen-15 isotopes, is crucial for studying the drug’s metabolic pathways, mechanism of action, and pharmacokinetics. Its stable isotope labeling ensures precise and reliable analytical results, making it ideal for applications in mass spectrometry and NMR spectroscopy. Amiloride-15N3 provides researchers with enhanced accuracy in tracing and quantifying the drug’s behavior in biological systems, supporting the development of more effective and safer therapeutic agents.
| Catalog Number | M125971 |
| CAS Number | 1217169-93-1 |
| Molecular Formula | C6H8ClN7O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3,5-diamino-N-[bis(azanyl)methylidene]-6-chloropyrazine-2-carboxamide |
| InChI | InChI=1S/C6H8ClN7O/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11/h(H4,8,9,13)(H4,10,11,14,15)/i10+1,11+1,14+1 |
| InChIKey | XSDQTOBWRPYKKA-MKZAMGNXSA-N |
| SMILES | C1(=C(N=C(C(=N1)Cl)N)N)C(=O)N=C(N)N |
