For research use only. Not for therapeutic Use.
Amiloride Hydrochloride Dihydrate is a potassium-sparing diuretic used to treat conditions such as hypertension and edema (fluid retention). It works by inhibiting sodium reabsorption in the kidneys, specifically in the distal tubules, which helps reduce fluid retention without causing excessive potassium loss. This makes it beneficial in preventing hypokalemia (low potassium levels), a common side effect of other diuretics. Amiloride is often used in combination with other diuretics to enhance its efficacy and maintain electrolyte balance.
CAS Number | 17440-83-4 |
Synonyms | 17440-83-4; Modamide; Nirulid; Amiloride HCL; Amilorid hydrochlorid-2-wasser |
Molecular Formula | C6H13Cl2N7O3 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | >14.1mg/mL in DMSO |
Storage | -20°C |
IUPAC Name | 3,5-diamino-6-chloro-N-(diaminomethylidene)pyrazine-2-carboxamide;dihydrate;hydrochloride |
InChI | InChI=1S/C6H8ClN7O.ClH/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11;/h(H4,8,9,13)(H4,10,11,14,15);1H |
InChIKey | LTKVFMLMEYCWMK-UHFFFAOYSA-N |
SMILES | C1(=C(N=C(C(=N1)Cl)N)N)C(=O)N=C(N)N.O.O.Cl |